| Name | Cyclopropyl phenyl ketone |
| Synonyms | Benzoylcyclopropane BENZOYLCYCLOPROPANE Cyclopropyl phenyl k CYCLOPROPYL PHENYL KETONE Cyclopropyl phenyl ketone Phenyl cyclopropyl ketone CYCLOPROPYL-PHENYL-METHANONE cyclopropyl(phenyl)methanone Methanone,cyclopropylphenyl- |
| CAS | 3481-02-5 |
| EINECS | 222-458-2 |
| InChI | InChI=1/C10H10O/c11-10(9-6-7-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| Molecular Formula | C10H10O |
| Molar Mass | 146.19 |
| Density | 1.058g/mLat 25°C(lit.) |
| Melting Point | 7-9°C(lit.) |
| Boling Point | 121-123°C15mm Hg(lit.) |
| Flash Point | 195°F |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.034mmHg at 25°C |
| Vapor Density | 5 (vs air) |
| Appearance | clear liquid |
| Color | Colorless to Light yellow |
| BRN | 1860145 |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | n20/D 1.553(lit.) |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |